C19H21N3O7 — CID 3783954
ethyl N-[[2-[2-(2-methoxyphenoxy)ethoxy]-5-nitrophenyl]methylideneamino]carbamate (PubChem CID 3783954) has the molecular formula C19H21N3O7 and a molecular weight of 403.39 g/mol. Its IUPAC name is ethyl N-[[2-[2-(2-methoxyphenoxy)ethoxy]-5-nitrophenyl]methylideneamino]carbamate.
| Compound Name | ethyl N-[[2-[2-(2-methoxyphenoxy)ethoxy]-5-nitrophenyl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 3783954 |
| Molecular Formula | C19H21N3O7 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | ethyl N-[[2-[2-(2-methoxyphenoxy)ethoxy]-5-nitrophenyl]methylideneamino]carbamate |
| SMILES | CCOC(=O)NN=Cc1cc([N+](=O)[O-])ccc1OCCOc1ccccc1OC |
| InChI | InChI=1S/C19H21N3O7/c1-3-27-19(23)21-20-13-14-12-15(22(24)25)8-9-16(14)28-10-11-29-18-7-5-4-6-17(18)26-2/h4-9,12-13H,3,10-11H2,1-2H3,(H,21,23) |
| InChIKey | ONQQYFVCRCQUHY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|