C10H14N5O4+ — CID 6748076
[[amino(nitramido)methylidene]amino]-[(2,4-dimethoxyphenyl)methylidene]azanium (PubChem CID 6748076) has the molecular formula C10H14N5O4+ and a molecular weight of 268.25 g/mol. Its IUPAC name is [[amino(nitramido)methylidene]amino]-[(2,4-dimethoxyphenyl)methylidene]azanium.
| Compound Name | [[amino(nitramido)methylidene]amino]-[(2,4-dimethoxyphenyl)methylidene]azanium |
|---|---|
| PubChem CID | 6748076 |
| Molecular Formula | C10H14N5O4+ |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | [[amino(nitramido)methylidene]amino]-[(2,4-dimethoxyphenyl)methylidene]azanium |
| SMILES | COc1ccc(C=[NH+]N=C(N)N[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C10H13N5O4/c1-18-8-4-3-7(9(5-8)19-2)6-12-13-10(11)14-15(16)17/h3-6H,1-2H3,(H3,11,13,14)/p+1 |
| InChIKey | JBGNSGHDTKKNKE-UHFFFAOYSA-O |
| XLogP | -1.79 |
| TPSA | 125.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|