C13H13N5O4 — CID 6884838
2-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]acetamide (PubChem CID 6884838) has the molecular formula C13H13N5O4 and a molecular weight of 303.28 g/mol. Its IUPAC name is 2-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6884838 |
| Molecular Formula | C13H13N5O4 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]acetamide |
| SMILES | Cc1[nH][nH]c(=O)c1CC(=O)N/N=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H13N5O4/c1-8-11(13(20)17-15-8)6-12(19)16-14-7-9-2-4-10(5-3-9)18(21)22/h2-5,7H,6H2,1H3,(H,16,19)(H2,15,17,20)/b14-7+ |
| InChIKey | DPLVKRPPRNZJPZ-VGOFMYFVSA-N |
| XLogP | 0.61 |
| TPSA | 133.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|