C17H19ClN4O4 — CID 110526004
N-[(E)-(3-chloro-4,5-diethoxyphenyl)methylideneamino]-6-methyl-2-oxo-1H-pyrimidine-4-carboxamide (PubChem CID 110526004) has the molecular formula C17H19ClN4O4 and a molecular weight of 378.82 g/mol. Its IUPAC name is N-[(E)-(3-chloro-4,5-diethoxyphenyl)methylideneamino]-6-methyl-2-oxo-1H-pyrimidine-4-carboxamide.
| Compound Name | N-[(E)-(3-chloro-4,5-diethoxyphenyl)methylideneamino]-6-methyl-2-oxo-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 110526004 |
| Molecular Formula | C17H19ClN4O4 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | N-[(E)-(3-chloro-4,5-diethoxyphenyl)methylideneamino]-6-methyl-2-oxo-1H-pyrimidine-4-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2cc(C)[nH]c(=O)n2)cc(Cl)c1OCC |
| InChI | InChI=1S/C17H19ClN4O4/c1-4-25-14-8-11(7-12(18)15(14)26-5-2)9-19-22-16(23)13-6-10(3)20-17(24)21-13/h6-9H,4-5H2,1-3H3,(H,22,23)(H,20,21,24)/b19-9+ |
| InChIKey | KYGJISXASZIJMQ-DJKKODMXSA-N |
| XLogP | 2.29 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|