C15H15N5O6 — CID 110525992
N-[(E)-(3,4-dimethoxy-5-nitrophenyl)methylideneamino]-6-methyl-2-oxo-1H-pyrimidine-4-carboxamide (PubChem CID 110525992) has the molecular formula C15H15N5O6 and a molecular weight of 361.31 g/mol. Its IUPAC name is N-[(E)-(3,4-dimethoxy-5-nitrophenyl)methylideneamino]-6-methyl-2-oxo-1H-pyrimidine-4-carboxamide.
| Compound Name | N-[(E)-(3,4-dimethoxy-5-nitrophenyl)methylideneamino]-6-methyl-2-oxo-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 110525992 |
| Molecular Formula | C15H15N5O6 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-[(E)-(3,4-dimethoxy-5-nitrophenyl)methylideneamino]-6-methyl-2-oxo-1H-pyrimidine-4-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2cc(C)[nH]c(=O)n2)cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C15H15N5O6/c1-8-4-10(18-15(22)17-8)14(21)19-16-7-9-5-11(20(23)24)13(26-3)12(6-9)25-2/h4-7H,1-3H3,(H,19,21)(H,17,18,22)/b16-7+ |
| InChIKey | GTWOFWVGIDSJKQ-FRKPEAEDSA-N |
| XLogP | 0.77 |
| TPSA | 148.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|