C18H21ClN4O4 — CID 110526005
N-[(E)-(3-chloro-5-ethoxy-4-propoxyphenyl)methylideneamino]-6-methyl-2-oxo-1H-pyrimidine-4-carboxamide (PubChem CID 110526005) has the molecular formula C18H21ClN4O4 and a molecular weight of 392.84 g/mol. Its IUPAC name is N-[(E)-(3-chloro-5-ethoxy-4-propoxyphenyl)methylideneamino]-6-methyl-2-oxo-1H-pyrimidine-4-carboxamide.
| Compound Name | N-[(E)-(3-chloro-5-ethoxy-4-propoxyphenyl)methylideneamino]-6-methyl-2-oxo-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 110526005 |
| Molecular Formula | C18H21ClN4O4 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-[(E)-(3-chloro-5-ethoxy-4-propoxyphenyl)methylideneamino]-6-methyl-2-oxo-1H-pyrimidine-4-carboxamide |
| SMILES | CCCOc1c(Cl)cc(/C=N/NC(=O)c2cc(C)[nH]c(=O)n2)cc1OCC |
| InChI | InChI=1S/C18H21ClN4O4/c1-4-6-27-16-13(19)8-12(9-15(16)26-5-2)10-20-23-17(24)14-7-11(3)21-18(25)22-14/h7-10H,4-6H2,1-3H3,(H,23,24)(H,21,22,25)/b20-10+ |
| InChIKey | YBNRGXNAGPQEGL-KEBDBYFISA-N |
| XLogP | 2.68 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|