C22H25ClN2O7 — CID 126340491
2-[2-chloro-4-[(E)-[(3,4-diethoxybenzoyl)hydrazinylidene]methyl]-6-ethoxyphenoxy]acetic acid (PubChem CID 126340491) has the molecular formula C22H25ClN2O7 and a molecular weight of 464.90 g/mol. Its IUPAC name is 2-[2-chloro-4-[(E)-[(3,4-diethoxybenzoyl)hydrazinylidene]methyl]-6-ethoxyphenoxy]acetic acid.
| Compound Name | 2-[2-chloro-4-[(E)-[(3,4-diethoxybenzoyl)hydrazinylidene]methyl]-6-ethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126340491 |
| Molecular Formula | C22H25ClN2O7 |
| Molecular Weight | 464.90 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 2-[2-chloro-4-[(E)-[(3,4-diethoxybenzoyl)hydrazinylidene]methyl]-6-ethoxyphenoxy]acetic acid |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2cc(Cl)c(OCC(=O)O)c(OCC)c2)cc1OCC |
| InChI | InChI=1S/C22H25ClN2O7/c1-4-29-17-8-7-15(11-18(17)30-5-2)22(28)25-24-12-14-9-16(23)21(32-13-20(26)27)19(10-14)31-6-3/h7-12H,4-6,13H2,1-3H3,(H,25,28)(H,26,27)/b24-12+ |
| InChIKey | KZOXKTVAJYMQFB-WYMPLXKRSA-N |
| XLogP | 3.76 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.90 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|