C17H19BrN4O5 — CID 110526228
N-[(Z)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide (PubChem CID 110526228) has the molecular formula C17H19BrN4O5 and a molecular weight of 439.27 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide.
| Compound Name | N-[(Z)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 110526228 |
| Molecular Formula | C17H19BrN4O5 |
| Molecular Weight | 439.27 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | N-[(Z)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide |
| SMILES | CCOc1c(Br)cc(/C=N\NC(=O)Cc2c(C)[nH]c(=O)[nH]c2=O)cc1OC |
| InChI | InChI=1S/C17H19BrN4O5/c1-4-27-15-12(18)5-10(6-13(15)26-3)8-19-22-14(23)7-11-9(2)20-17(25)21-16(11)24/h5-6,8H,4,7H2,1-3H3,(H,22,23)(H2,20,21,24,25)/b19-8- |
| InChIKey | WZVHERREPNMSEZ-UWVJOHFNSA-N |
| XLogP | 1.23 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|