C18H18BrClN2O4 — CID 19190528
N-[(E)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-2-(3-chlorophenoxy)acetamide (PubChem CID 19190528) has the molecular formula C18H18BrClN2O4 and a molecular weight of 441.71 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-2-(3-chlorophenoxy)acetamide.
| Compound Name | N-[(E)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-2-(3-chlorophenoxy)acetamide |
|---|---|
| PubChem CID | 19190528 |
| Molecular Formula | C18H18BrClN2O4 |
| Molecular Weight | 441.71 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | N-[(E)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-2-(3-chlorophenoxy)acetamide |
| SMILES | CCOc1c(Br)cc(/C=N/NC(=O)COc2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C18H18BrClN2O4/c1-3-25-18-15(19)7-12(8-16(18)24-2)10-21-22-17(23)11-26-14-6-4-5-13(20)9-14/h4-10H,3,11H2,1-2H3,(H,22,23)/b21-10+ |
| InChIKey | OZUYVUQMIKTYTN-UFFVCSGVSA-N |
| XLogP | 4.04 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.71 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|