C25H25BrN2O4 — CID 19190864
N-[(E)-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-(3,4-dimethylphenoxy)acetamide (PubChem CID 19190864) has the molecular formula C25H25BrN2O4 and a molecular weight of 497.39 g/mol. Its IUPAC name is N-[(E)-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-(3,4-dimethylphenoxy)acetamide.
| Compound Name | N-[(E)-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-(3,4-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 19190864 |
| Molecular Formula | C25H25BrN2O4 |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | N-[(E)-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-(3,4-dimethylphenoxy)acetamide |
| SMILES | COc1cc(/C=N/NC(=O)COc2ccc(C)c(C)c2)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H25BrN2O4/c1-17-9-10-21(11-18(17)2)31-16-24(29)28-27-14-20-12-22(26)25(23(13-20)30-3)32-15-19-7-5-4-6-8-19/h4-14H,15-16H2,1-3H3,(H,28,29)/b27-14+ |
| InChIKey | DTWINIVKMINHPY-MZJWZYIUSA-N |
| XLogP | 5.18 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|