C15H13F3N4O3 — CID 110526114
2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]acetamide (PubChem CID 110526114) has the molecular formula C15H13F3N4O3 and a molecular weight of 354.29 g/mol. Its IUPAC name is 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 110526114 |
| Molecular Formula | C15H13F3N4O3 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1CC(=O)N/N=C\c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H13F3N4O3/c1-8-11(13(24)21-14(25)20-8)6-12(23)22-19-7-9-3-2-4-10(5-9)15(16,17)18/h2-5,7H,6H2,1H3,(H,22,23)(H2,20,21,24,25)/b19-7- |
| InChIKey | HSNNOFHYXKRHBN-GXHLCREISA-N |
| XLogP | 1.08 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|