C13H13N7O6 — CID 135750550
(2R)-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(4-hydroxy-3-nitrophenyl)methylideneamino]propanamide (PubChem CID 135750550) has the molecular formula C13H13N7O6 and a molecular weight of 363.29 g/mol. Its IUPAC name is (2R)-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(4-hydroxy-3-nitrophenyl)methylideneamino]propanamide.
| Compound Name | (2R)-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(4-hydroxy-3-nitrophenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 135750550 |
| Molecular Formula | C13H13N7O6 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | (2R)-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(4-hydroxy-3-nitrophenyl)methylideneamino]propanamide |
| SMILES | C[C@@H](Nc1n[nH]c(=O)[nH]c1=O)C(=O)N/N=C/c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H13N7O6/c1-6(15-10-12(23)16-13(24)19-17-10)11(22)18-14-5-7-2-3-9(21)8(4-7)20(25)26/h2-6,21H,1H3,(H,15,17)(H,18,22)(H2,16,19,23,24)/b14-5+/t6-/m1/s1 |
| InChIKey | RYJVUXZLNMOUIL-DXOCJUPFSA-N |
| XLogP | -0.98 |
| TPSA | 195.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|