C18H18ClN3O5 — CID 135805022
2-(4-chloro-3,5-dimethylphenoxy)-N-[(E)-(4-hydroxy-3-nitrophenyl)methylideneamino]propanamide (PubChem CID 135805022) has the molecular formula C18H18ClN3O5 and a molecular weight of 391.81 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)-N-[(E)-(4-hydroxy-3-nitrophenyl)methylideneamino]propanamide.
| Compound Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-[(E)-(4-hydroxy-3-nitrophenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 135805022 |
| Molecular Formula | C18H18ClN3O5 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-[(E)-(4-hydroxy-3-nitrophenyl)methylideneamino]propanamide |
| SMILES | Cc1cc(OC(C)C(=O)N/N=C/c2ccc(O)c([N+](=O)[O-])c2)cc(C)c1Cl |
| InChI | InChI=1S/C18H18ClN3O5/c1-10-6-14(7-11(2)17(10)19)27-12(3)18(24)21-20-9-13-4-5-16(23)15(8-13)22(25)26/h4-9,12,23H,1-3H3,(H,21,24)/b20-9+ |
| InChIKey | DOJCWWYGAJQCRF-AWQFTUOYSA-N |
| XLogP | 3.49 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|