C14H12N6O3S — CID 136904646
2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-1H-indol-3-ylmethylideneamino]acetamide (PubChem CID 136904646) has the molecular formula C14H12N6O3S and a molecular weight of 344.36 g/mol. Its IUPAC name is 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-1H-indol-3-ylmethylideneamino]acetamide.
| Compound Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-1H-indol-3-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 136904646 |
| Molecular Formula | C14H12N6O3S |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-1H-indol-3-ylmethylideneamino]acetamide |
| SMILES | O=C(CSc1n[nH]c(=O)[nH]c1=O)N/N=C\c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H12N6O3S/c21-11(7-24-13-12(22)17-14(23)20-19-13)18-16-6-8-5-15-10-4-2-1-3-9(8)10/h1-6,15H,7H2,(H,18,21)(H2,17,20,22,23)/b16-6- |
| InChIKey | DFDZOCAHCWFKFM-SOFYXZRVSA-N |
| XLogP | 0.18 |
| TPSA | 135.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|