C15H15N3O5 — CID 4830198
methyl 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-3-phenylpropanoate (PubChem CID 4830198) has the molecular formula C15H15N3O5 and a molecular weight of 317.30 g/mol. Its IUPAC name is methyl 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-3-phenylpropanoate.
| Compound Name | methyl 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 4830198 |
| Molecular Formula | C15H15N3O5 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | methyl 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)/N=C/c1c(O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H15N3O5/c1-23-14(21)11(7-9-5-3-2-4-6-9)16-8-10-12(19)17-15(22)18-13(10)20/h2-6,8,11H,7H2,1H3,(H3,17,18,19,20,22)/b16-8+ |
| InChIKey | ULXWZMKJJAJUFM-LZYBPNLTSA-N |
| XLogP | -0.03 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|