C14H13N3O5S — CID 135652009
2-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylideneamino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 135652009) has the molecular formula C14H13N3O5S and a molecular weight of 335.34 g/mol. Its IUPAC name is 2-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylideneamino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylideneamino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 135652009 |
| Molecular Formula | C14H13N3O5S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylideneamino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(O)cc1)/N=C/c1c(O)[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C14H13N3O5S/c18-8-3-1-7(2-4-8)5-10(13(21)22)15-6-9-11(19)16-14(23)17-12(9)20/h1-4,6,10,18H,5H2,(H,21,22)(H3,16,17,19,20,23)/b15-6+ |
| InChIKey | JTDDACXYBBUUBI-GIDUJCDVSA-N |
| XLogP | 0.96 |
| TPSA | 138.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|