C17H19N3O6 — CID 7694259
(2R)-3-(4-hydroxyphenyl)-2-[[(5R)-2,4,6-trioxo-1-propan-2-yl-1,3-diazinan-5-yl]methylideneamino]propanoic acid (PubChem CID 7694259) has the molecular formula C17H19N3O6 and a molecular weight of 361.35 g/mol. Its IUPAC name is (2R)-3-(4-hydroxyphenyl)-2-[[(5R)-2,4,6-trioxo-1-propan-2-yl-1,3-diazinan-5-yl]methylideneamino]propanoic acid.
| Compound Name | (2R)-3-(4-hydroxyphenyl)-2-[[(5R)-2,4,6-trioxo-1-propan-2-yl-1,3-diazinan-5-yl]methylideneamino]propanoic acid |
|---|---|
| PubChem CID | 7694259 |
| Molecular Formula | C17H19N3O6 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (2R)-3-(4-hydroxyphenyl)-2-[[(5R)-2,4,6-trioxo-1-propan-2-yl-1,3-diazinan-5-yl]methylideneamino]propanoic acid |
| SMILES | CC(C)N1C(=O)NC(=O)[C@@H](/C=N/[C@H](Cc2ccc(O)cc2)C(=O)O)C1=O |
| InChI | InChI=1S/C17H19N3O6/c1-9(2)20-15(23)12(14(22)19-17(20)26)8-18-13(16(24)25)7-10-3-5-11(21)6-4-10/h3-6,8-9,12-13,21H,7H2,1-2H3,(H,24,25)(H,19,22,26)/b18-8+/t12-,13-/m1/s1 |
| InChIKey | JNKFOVBGMKKDQC-IRQFNLTPSA-N |
| XLogP | 0.56 |
| TPSA | 136.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|