4-(2-methylpropyl)phenol;propanoic acid

C13H20O3 — CID 174874916

IUPAC4-(2-methylpropyl)phenol;propanoic acid
SMILESCC(C)Cc1ccc(O)cc1.CCC(=O)O
InChIInChI=1S/C10H14O.C3H6O2/c1-8(2)7-9-3-5-10(11)6-4-9;1-2-3(4)5/h3-6,8,11H,7H2,1-2H3;2H2,1H3,(H,4,5)
InChIKeyGMYWPHDGTMOELU-UHFFFAOYSA-N
MW224.30 g/mol
LogP3.07
Rot. Bonds3

About 4-(2-methylpropyl)phenol;propanoic acid

4-(2-methylpropyl)phenol;propanoic acid (PubChem CID 174874916) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 4-(2-methylpropyl)phenol;propanoic acid.

Molecular Properties

Compound Name4-(2-methylpropyl)phenol;propanoic acid
PubChem CID174874916
Molecular FormulaC13H20O3
Molecular Weight224.30 g/mol
Exact Mass224.14
IUPAC Name4-(2-methylpropyl)phenol;propanoic acid
SMILESCC(C)Cc1ccc(O)cc1.CCC(=O)O
InChIInChI=1S/C10H14O.C3H6O2/c1-8(2)7-9-3-5-10(11)6-4-9;1-2-3(4)5/h3-6,8,11H,7H2,1-2H3;2H2,1H3,(H,4,5)
InChIKeyGMYWPHDGTMOELU-UHFFFAOYSA-N
XLogP3.07
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.30
LogP ≤ 53.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-(2-methylpropyl)phenol;propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-methylpropyl)phenol;propanoic acid?
The IUPAC name of 4-(2-methylpropyl)phenol;propanoic acid (CID 174874916) is 4-(2-methylpropyl)phenol;propanoic acid.
What is the SMILES notation for 4-(2-methylpropyl)phenol;propanoic acid?
The canonical SMILES for 4-(2-methylpropyl)phenol;propanoic acid is CC(C)Cc1ccc(O)cc1.CCC(=O)O.
What is the InChIKey of 4-(2-methylpropyl)phenol;propanoic acid?
The InChIKey is GMYWPHDGTMOELU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C3H6O2/c1-8(2)7-9-3-5-10(11)6-4-9;1-2-3(4)5/h3-6,8,11H,7H2,1-2H3;2H2,1H3,(H,4,5).
What are the key properties of 4-(2-methylpropyl)phenol;propanoic acid?
4-(2-methylpropyl)phenol;propanoic acid has a molecular weight of 224.30 g/mol, XLogP of 3.07, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylpropyl)phenol;propanoic acid is sourced from PubChem (CID 174874916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).