C16H22N2O6 — CID 174375456
2-amino-4-methylpentanoic acid;3-(4-hydroxyphenyl)-2-isocyanatopropanoic acid (PubChem CID 174375456) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-amino-4-methylpentanoic acid;3-(4-hydroxyphenyl)-2-isocyanatopropanoic acid.
| Compound Name | 2-amino-4-methylpentanoic acid;3-(4-hydroxyphenyl)-2-isocyanatopropanoic acid |
|---|---|
| PubChem CID | 174375456 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-amino-4-methylpentanoic acid;3-(4-hydroxyphenyl)-2-isocyanatopropanoic acid |
| SMILES | CC(C)CC(N)C(=O)O.O=C=NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C10H9NO4.C6H13NO2/c12-6-11-9(10(14)15)5-7-1-3-8(13)4-2-7;1-4(2)3-5(7)6(8)9/h1-4,9,13H,5H2,(H,14,15);4-5H,3,7H2,1-2H3,(H,8,9) |
| InChIKey | QFPAUNIOAXOFEN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 150.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|