C18H29N3O6 — CID 87353416
(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;[(2S)-2-aminopropanoyl] (2S)-2-amino-4-methylpentanoate (PubChem CID 87353416) has the molecular formula C18H29N3O6 and a molecular weight of 383.45 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;[(2S)-2-aminopropanoyl] (2S)-2-amino-4-methylpentanoate.
| Compound Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;[(2S)-2-aminopropanoyl] (2S)-2-amino-4-methylpentanoate |
|---|---|
| PubChem CID | 87353416 |
| Molecular Formula | C18H29N3O6 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;[(2S)-2-aminopropanoyl] (2S)-2-amino-4-methylpentanoate |
| SMILES | CC(C)C[C@H](N)C(=O)OC(=O)[C@H](C)N.N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C9H18N2O3.C9H11NO3/c1-5(2)4-7(11)9(13)14-8(12)6(3)10;10-8(9(12)13)5-6-1-3-7(11)4-2-6/h5-7H,4,10-11H2,1-3H3;1-4,8,11H,5,10H2,(H,12,13)/t6-,7-;8-/m00/s1 |
| InChIKey | FMQUQWBPWKFDKH-DWOOVIBVSA-N |
| XLogP | 0.12 |
| TPSA | 178.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|