C11H13NO4 — CID 170163400
2-amino-3-(4-hydroxyphenyl)propanoic acid;ethenone (PubChem CID 170163400) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2-amino-3-(4-hydroxyphenyl)propanoic acid;ethenone.
| Compound Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;ethenone |
|---|---|
| PubChem CID | 170163400 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;ethenone |
| SMILES | C=C=O.NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C9H11NO3.C2H2O/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;1-2-3/h1-4,8,11H,5,10H2,(H,12,13);1H2 |
| InChIKey | NDQBNGQPBCIPOD-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|