C17H21N2O8P — CID 155289185
(2S)-3-(4-hydroxyphenyl)-2-[[2-methyl-3-oxo-5-(phosphonooxymethyl)-2,4-dihydro-1H-pyridin-4-yl]methylideneamino]propanoic acid (PubChem CID 155289185) has the molecular formula C17H21N2O8P and a molecular weight of 412.34 g/mol. Its IUPAC name is (2S)-3-(4-hydroxyphenyl)-2-[[2-methyl-3-oxo-5-(phosphonooxymethyl)-2,4-dihydro-1H-pyridin-4-yl]methylideneamino]propanoic acid.
| Compound Name | (2S)-3-(4-hydroxyphenyl)-2-[[2-methyl-3-oxo-5-(phosphonooxymethyl)-2,4-dihydro-1H-pyridin-4-yl]methylideneamino]propanoic acid |
|---|---|
| PubChem CID | 155289185 |
| Molecular Formula | C17H21N2O8P |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | (2S)-3-(4-hydroxyphenyl)-2-[[2-methyl-3-oxo-5-(phosphonooxymethyl)-2,4-dihydro-1H-pyridin-4-yl]methylideneamino]propanoic acid |
| SMILES | CC1NC=C(COP(=O)(O)O)C(/C=N/[C@@H](Cc2ccc(O)cc2)C(=O)O)C1=O |
| InChI | InChI=1S/C17H21N2O8P/c1-10-16(21)14(12(7-18-10)9-27-28(24,25)26)8-19-15(17(22)23)6-11-2-4-13(20)5-3-11/h2-5,7-8,10,14-15,18,20H,6,9H2,1H3,(H,22,23)(H2,24,25,26)/b19-8+/t10?,14?,15-/m0/s1 |
| InChIKey | UKLQQXWTGIHGNU-XYMLDSCSSA-N |
| XLogP | 0.63 |
| TPSA | 165.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|