C17H20N2O8P+ — CID 135567424
[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylidene]azanium (PubChem CID 135567424) has the molecular formula C17H20N2O8P+ and a molecular weight of 411.33 g/mol. Its IUPAC name is [(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylidene]azanium.
| Compound Name | [(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylidene]azanium |
|---|---|
| PubChem CID | 135567424 |
| Molecular Formula | C17H20N2O8P+ |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | [(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylidene]azanium |
| SMILES | Cc1ncc(COP(=O)(O)O)c(/C=[NH+]/[C@@H](Cc2ccc(O)cc2)C(=O)O)c1O |
| InChI | InChI=1S/C17H19N2O8P/c1-10-16(21)14(12(7-18-10)9-27-28(24,25)26)8-19-15(17(22)23)6-11-2-4-13(20)5-3-11/h2-5,7-8,15,20-21H,6,9H2,1H3,(H,22,23)(H2,24,25,26)/p+1/b19-8+/t15-/m0/s1 |
| InChIKey | CKCDOIZMSQGLNR-UZSVJVCZSA-O |
| XLogP | -0.39 |
| TPSA | 171.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|