C11H15N2O8P — CID 137348001
(2R)-3-hydroxy-2-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylideneamino]propanoic acid (PubChem CID 137348001) has the molecular formula C11H15N2O8P and a molecular weight of 334.22 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylideneamino]propanoic acid.
| Compound Name | (2R)-3-hydroxy-2-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylideneamino]propanoic acid |
|---|---|
| PubChem CID | 137348001 |
| Molecular Formula | C11H15N2O8P |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | (2R)-3-hydroxy-2-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylideneamino]propanoic acid |
| SMILES | Cc1ncc(COP(=O)(O)O)c(/C=N/[C@H](CO)C(=O)O)c1O |
| InChI | InChI=1S/C11H15N2O8P/c1-6-10(15)8(3-13-9(4-14)11(16)17)7(2-12-6)5-21-22(18,19)20/h2-3,9,14-15H,4-5H2,1H3,(H,16,17)(H2,18,19,20)/b13-3+/t9-/m1/s1 |
| InChIKey | ZTQZHYMXYBDMIL-RZTFRGLUSA-N |
| XLogP | -0.43 |
| TPSA | 169.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|