C11H17CuN2O8P — CID 135539769
copper;2-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylideneamino]propanoic acid;hydrate (PubChem CID 135539769) has the molecular formula C11H17CuN2O8P and a molecular weight of 399.78 g/mol. Its IUPAC name is copper;2-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylideneamino]propanoic acid;hydrate.
| Compound Name | copper;2-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylideneamino]propanoic acid;hydrate |
|---|---|
| PubChem CID | 135539769 |
| Molecular Formula | C11H17CuN2O8P |
| Molecular Weight | 399.78 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | copper;2-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylideneamino]propanoic acid;hydrate |
| SMILES | Cc1ncc(COP(=O)(O)O)c(/C=N/C(C)C(=O)O)c1O.O.[Cu] |
| InChI | InChI=1S/C11H15N2O7P.Cu.H2O/c1-6-10(14)9(4-13-7(2)11(15)16)8(3-12-6)5-20-21(17,18)19;;/h3-4,7,14H,5H2,1-2H3,(H,15,16)(H2,17,18,19);;1H2/b13-4+;; |
| InChIKey | VTRMQJNLBIOQMN-CXALCSDVSA-N |
| XLogP | -0.23 |
| TPSA | 181.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.78 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|