C19H31N2O6P — CID 137349872
[5-hydroxy-6-methyl-4-(2-oxoundecyliminomethyl)-3-pyridinyl]methyl dihydrogen phosphate (PubChem CID 137349872) has the molecular formula C19H31N2O6P and a molecular weight of 414.44 g/mol. Its IUPAC name is [5-hydroxy-6-methyl-4-(2-oxoundecyliminomethyl)-3-pyridinyl]methyl dihydrogen phosphate.
| Compound Name | [5-hydroxy-6-methyl-4-(2-oxoundecyliminomethyl)-3-pyridinyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 137349872 |
| Molecular Formula | C19H31N2O6P |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | [5-hydroxy-6-methyl-4-(2-oxoundecyliminomethyl)-3-pyridinyl]methyl dihydrogen phosphate |
| SMILES | CCCCCCCCCC(=O)C/N=C/c1c(COP(=O)(O)O)cnc(C)c1O |
| InChI | InChI=1S/C19H31N2O6P/c1-3-4-5-6-7-8-9-10-17(22)12-20-13-18-16(14-27-28(24,25)26)11-21-15(2)19(18)23/h11,13,23H,3-10,12,14H2,1-2H3,(H2,24,25,26)/b20-13+ |
| InChIKey | NFGPSQDCIMWBHR-DEDYPNTBSA-N |
| XLogP | 3.83 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|