C12H20N3O6P — CID 135503663
[4-[(E)-4-aminobutan-2-yloxyiminomethyl]-5-hydroxy-6-methyl-3-pyridinyl]methyl dihydrogen phosphate (PubChem CID 135503663) has the molecular formula C12H20N3O6P and a molecular weight of 333.28 g/mol. Its IUPAC name is [4-[(E)-4-aminobutan-2-yloxyiminomethyl]-5-hydroxy-6-methyl-3-pyridinyl]methyl dihydrogen phosphate.
| Compound Name | [4-[(E)-4-aminobutan-2-yloxyiminomethyl]-5-hydroxy-6-methyl-3-pyridinyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 135503663 |
| Molecular Formula | C12H20N3O6P |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | [4-[(E)-4-aminobutan-2-yloxyiminomethyl]-5-hydroxy-6-methyl-3-pyridinyl]methyl dihydrogen phosphate |
| SMILES | Cc1ncc(COP(=O)(O)O)c(/C=N/OC(C)CCN)c1O |
| InChI | InChI=1S/C12H20N3O6P/c1-8(3-4-13)21-15-6-11-10(7-20-22(17,18)19)5-14-9(2)12(11)16/h5-6,8,16H,3-4,7,13H2,1-2H3,(H2,17,18,19)/b15-6+ |
| InChIKey | SARGSDCOXDFIEJ-GIDUJCDVSA-N |
| XLogP | 0.79 |
| TPSA | 147.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|