C8H8CaNO6P — CID 6453762
calcium (4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl phosphate (PubChem CID 6453762) has the molecular formula C8H8CaNO6P and a molecular weight of 285.20 g/mol. Its IUPAC name is calcium (4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl phosphate.
| Compound Name | calcium (4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl phosphate |
|---|---|
| PubChem CID | 6453762 |
| Molecular Formula | C8H8CaNO6P |
| Molecular Weight | 285.20 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | calcium (4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl phosphate |
| SMILES | Cc1ncc(COP(=O)([O-])[O-])c(C=O)c1O.[Ca+2] |
| InChI | InChI=1S/C8H10NO6P.Ca/c1-5-8(11)7(3-10)6(2-9-5)4-15-16(12,13)14;/h2-3,11H,4H2,1H3,(H2,12,13,14);/q;+2/p-2 |
| InChIKey | FHUYQVNATYLYKD-UHFFFAOYSA-L |
| XLogP | -1.13 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.20 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|