C14H19NNa2O14P2 — CID 53428451
disodium;[(4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methoxy-oxidophosphoryl] [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate (PubChem CID 53428451) has the molecular formula C14H19NNa2O14P2 and a molecular weight of 533.23 g/mol. Its IUPAC name is disodium;[(4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methoxy-oxidophosphoryl] [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate.
| Compound Name | disodium;[(4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methoxy-oxidophosphoryl] [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
|---|---|
| PubChem CID | 53428451 |
| Molecular Formula | C14H19NNa2O14P2 |
| Molecular Weight | 533.23 g/mol |
| Exact Mass | 533.01 |
| IUPAC Name | disodium;[(4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methoxy-oxidophosphoryl] [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
| SMILES | Cc1ncc(COP(=O)([O-])OP(=O)([O-])OC2OC(CO)C(O)C(O)C2O)c(C=O)c1O.[Na+].[Na+] |
| InChI | InChI=1S/C14H21NO14P2.2Na/c1-6-10(18)8(3-16)7(2-15-6)5-26-30(22,23)29-31(24,25)28-14-13(21)12(20)11(19)9(4-17)27-14;;/h2-3,9,11-14,17-21H,4-5H2,1H3,(H,22,23)(H,24,25);;/q;2*+1/p-2 |
| InChIKey | DBXOOCKABATHSN-UHFFFAOYSA-L |
| XLogP | -8.80 |
| TPSA | 248.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.23 |
| LogP ≤ 5 | -8.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|