C14H17N4O6PS — CID 136824451
[4-[(Z)-(furan-2-ylmethylcarbamothioylhydrazinylidene)methyl]-5-hydroxy-6-methyl-3-pyridinyl]methyl dihydrogen phosphate (PubChem CID 136824451) has the molecular formula C14H17N4O6PS and a molecular weight of 400.35 g/mol. Its IUPAC name is [4-[(Z)-(furan-2-ylmethylcarbamothioylhydrazinylidene)methyl]-5-hydroxy-6-methyl-3-pyridinyl]methyl dihydrogen phosphate.
| Compound Name | [4-[(Z)-(furan-2-ylmethylcarbamothioylhydrazinylidene)methyl]-5-hydroxy-6-methyl-3-pyridinyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 136824451 |
| Molecular Formula | C14H17N4O6PS |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | [4-[(Z)-(furan-2-ylmethylcarbamothioylhydrazinylidene)methyl]-5-hydroxy-6-methyl-3-pyridinyl]methyl dihydrogen phosphate |
| SMILES | Cc1ncc(COP(=O)(O)O)c(/C=N\NC(=S)NCc2ccco2)c1O |
| InChI | InChI=1S/C14H17N4O6PS/c1-9-13(19)12(10(5-15-9)8-24-25(20,21)22)7-17-18-14(26)16-6-11-3-2-4-23-11/h2-5,7,19H,6,8H2,1H3,(H2,16,18,26)(H2,20,21,22)/b17-7- |
| InChIKey | IOGIFACKSKXVGD-IDUWFGFVSA-N |
| XLogP | 1.30 |
| TPSA | 149.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|