C15H17N3O2S — CID 9396679
1-(furan-2-ylmethyl)-3-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]thiourea (PubChem CID 9396679) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 9396679 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]thiourea |
| SMILES | C[C@@H]1C[C@H]1c1ccc(/C=N\NC(=S)NCc2ccco2)o1 |
| InChI | InChI=1S/C15H17N3O2S/c1-10-7-13(10)14-5-4-12(20-14)9-17-18-15(21)16-8-11-3-2-6-19-11/h2-6,9-10,13H,7-8H2,1H3,(H2,16,18,21)/b17-9-/t10-,13-/m1/s1 |
| InChIKey | RFUDMZKHMXXGHL-NSHRYQRRSA-N |
| XLogP | 2.99 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|