C14H15N2O7P — CID 162052954
3-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylideneamino]cyclopenta-1,3-diene-1-carboxylic acid (PubChem CID 162052954) has the molecular formula C14H15N2O7P and a molecular weight of 354.26 g/mol. Its IUPAC name is 3-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylideneamino]cyclopenta-1,3-diene-1-carboxylic acid.
| Compound Name | 3-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylideneamino]cyclopenta-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 162052954 |
| Molecular Formula | C14H15N2O7P |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 3-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylideneamino]cyclopenta-1,3-diene-1-carboxylic acid |
| SMILES | Cc1ncc(COP(=O)(O)O)c(/C=N/C2=CCC(C(=O)O)=C2)c1O |
| InChI | InChI=1S/C14H15N2O7P/c1-8-13(17)12(10(5-15-8)7-23-24(20,21)22)6-16-11-3-2-9(4-11)14(18)19/h3-6,17H,2,7H2,1H3,(H,18,19)(H2,20,21,22)/b16-6+ |
| InChIKey | HGWHWRSGBYCVTH-OMCISZLKSA-N |
| XLogP | 1.42 |
| TPSA | 149.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|