C17H18N2O5 — CID 170906915
4-[2-[1-carboxy-2-(4-hydroxyphenyl)ethyl]iminoethylidene]-2,3-dihydro-1H-pyridine-6-carboxylic acid (PubChem CID 170906915) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is 4-[2-[1-carboxy-2-(4-hydroxyphenyl)ethyl]iminoethylidene]-2,3-dihydro-1H-pyridine-6-carboxylic acid.
| Compound Name | 4-[2-[1-carboxy-2-(4-hydroxyphenyl)ethyl]iminoethylidene]-2,3-dihydro-1H-pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 170906915 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 4-[2-[1-carboxy-2-(4-hydroxyphenyl)ethyl]iminoethylidene]-2,3-dihydro-1H-pyridine-6-carboxylic acid |
| SMILES | O=C(O)C1=CC(=C/C=N/C(Cc2ccc(O)cc2)C(=O)O)CCN1 |
| InChI | InChI=1S/C17H18N2O5/c20-13-3-1-11(2-4-13)9-14(16(21)22)18-7-5-12-6-8-19-15(10-12)17(23)24/h1-5,7,10,14,19-20H,6,8-9H2,(H,21,22)(H,23,24)/b12-5?,18-7+ |
| InChIKey | SQMVCBZAUCFQPR-CSQZTFDCSA-N |
| XLogP | 1.35 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|