C11H18N2O6 — CID 173239039
(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;aziridin-2-one;dihydrate (PubChem CID 173239039) has the molecular formula C11H18N2O6 and a molecular weight of 274.27 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;aziridin-2-one;dihydrate.
| Compound Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;aziridin-2-one;dihydrate |
|---|---|
| PubChem CID | 173239039 |
| Molecular Formula | C11H18N2O6 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;aziridin-2-one;dihydrate |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)O.O.O.O=C1CN1 |
| InChI | InChI=1S/C9H11NO3.C2H3NO.2H2O/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;4-2-1-3-2;;/h1-4,8,11H,5,10H2,(H,12,13);1H2,(H,3,4);2*1H2/t8-;;;/m0.../s1 |
| InChIKey | ONQHBUKVECKVNF-CZDIJEQGSA-N |
| XLogP | -2.19 |
| TPSA | 185.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|