C17H17NO4 — CID 25141583
(2S)-2-[2-(2,5-dihydroxyphenyl)ethylideneamino]-3-phenylpropanoic acid (PubChem CID 25141583) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is (2S)-2-[2-(2,5-dihydroxyphenyl)ethylideneamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[2-(2,5-dihydroxyphenyl)ethylideneamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 25141583 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (2S)-2-[2-(2,5-dihydroxyphenyl)ethylideneamino]-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1)/N=C/Cc1cc(O)ccc1O |
| InChI | InChI=1S/C17H17NO4/c19-14-6-7-16(20)13(11-14)8-9-18-15(17(21)22)10-12-4-2-1-3-5-12/h1-7,9,11,15,19-20H,8,10H2,(H,21,22)/b18-9+/t15-/m0/s1 |
| InChIKey | XDIAWUXGGPJZBU-UPAIAECRSA-N |
| XLogP | 2.41 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|