C18H23N3O8S — CID 87567713
(2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-[2-(2,5-dihydroxyphenyl)ethylideneamino]-5-oxopentanoic acid (PubChem CID 87567713) has the molecular formula C18H23N3O8S and a molecular weight of 441.46 g/mol. Its IUPAC name is (2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-[2-(2,5-dihydroxyphenyl)ethylideneamino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-[2-(2,5-dihydroxyphenyl)ethylideneamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 87567713 |
| Molecular Formula | C18H23N3O8S |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | (2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-[2-(2,5-dihydroxyphenyl)ethylideneamino]-5-oxopentanoic acid |
| SMILES | O=C(O)CNC(=O)[C@H](CS)NC(=O)CC[C@H](/N=C/Cc1cc(O)ccc1O)C(=O)O |
| InChI | InChI=1S/C18H23N3O8S/c22-11-1-3-14(23)10(7-11)5-6-19-12(18(28)29)2-4-15(24)21-13(9-30)17(27)20-8-16(25)26/h1,3,6-7,12-13,22-23,30H,2,4-5,8-9H2,(H,20,27)(H,21,24)(H,25,26)(H,28,29)/b19-6+/t12-,13-/m0/s1 |
| InChIKey | XRKQMCDOMOHYQV-GMVPJPDQSA-N |
| XLogP | -0.44 |
| TPSA | 185.62 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|