C14H18N2O6S2 — CID 87568464
(2R)-2-amino-3-[[(2R)-2-carboxy-2-[2-(2,4-dihydroxyphenyl)ethylideneamino]ethyl]disulfanyl]propanoic acid (PubChem CID 87568464) has the molecular formula C14H18N2O6S2 and a molecular weight of 374.44 g/mol. Its IUPAC name is (2R)-2-amino-3-[[(2R)-2-carboxy-2-[2-(2,4-dihydroxyphenyl)ethylideneamino]ethyl]disulfanyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[[(2R)-2-carboxy-2-[2-(2,4-dihydroxyphenyl)ethylideneamino]ethyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 87568464 |
| Molecular Formula | C14H18N2O6S2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | (2R)-2-amino-3-[[(2R)-2-carboxy-2-[2-(2,4-dihydroxyphenyl)ethylideneamino]ethyl]disulfanyl]propanoic acid |
| SMILES | N[C@@H](CSSC[C@H](/N=C/Cc1ccc(O)cc1O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H18N2O6S2/c15-10(13(19)20)6-23-24-7-11(14(21)22)16-4-3-8-1-2-9(17)5-12(8)18/h1-2,4-5,10-11,17-18H,3,6-7,15H2,(H,19,20)(H,21,22)/b16-4+/t10-,11-/m0/s1 |
| InChIKey | YKTJPDPZPXVUEP-QEGXLGTDSA-N |
| XLogP | 0.96 |
| TPSA | 153.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|