C14H20N2O7S2 — CID 140533933
3-[(2-amino-2-carboxyethyl)disulfanyl]-2-[1-(2,5-dihydroxyphenyl)ethylamino]-2-hydroxypropanoic acid (PubChem CID 140533933) has the molecular formula C14H20N2O7S2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-[(2-amino-2-carboxyethyl)disulfanyl]-2-[1-(2,5-dihydroxyphenyl)ethylamino]-2-hydroxypropanoic acid.
| Compound Name | 3-[(2-amino-2-carboxyethyl)disulfanyl]-2-[1-(2,5-dihydroxyphenyl)ethylamino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 140533933 |
| Molecular Formula | C14H20N2O7S2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 3-[(2-amino-2-carboxyethyl)disulfanyl]-2-[1-(2,5-dihydroxyphenyl)ethylamino]-2-hydroxypropanoic acid |
| SMILES | CC(NC(O)(CSSCC(N)C(=O)O)C(=O)O)c1cc(O)ccc1O |
| InChI | InChI=1S/C14H20N2O7S2/c1-7(9-4-8(17)2-3-11(9)18)16-14(23,13(21)22)6-25-24-5-10(15)12(19)20/h2-4,7,10,16-18,23H,5-6,15H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | LIGQVICAWTTYES-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 173.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|