C12H17NO4 — CID 174512800
2-amino-4-(2,5-dihydroxyphenyl)hexanoic acid (PubChem CID 174512800) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 2-amino-4-(2,5-dihydroxyphenyl)hexanoic acid.
| Compound Name | 2-amino-4-(2,5-dihydroxyphenyl)hexanoic acid |
|---|---|
| PubChem CID | 174512800 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 2-amino-4-(2,5-dihydroxyphenyl)hexanoic acid |
| SMILES | CCC(CC(N)C(=O)O)c1cc(O)ccc1O |
| InChI | InChI=1S/C12H17NO4/c1-2-7(5-10(13)12(16)17)9-6-8(14)3-4-11(9)15/h3-4,6-7,10,14-15H,2,5,13H2,1H3,(H,16,17) |
| InChIKey | RZAJPZYJPWLAFN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|