2-amino-4-(2,5-dihydroxyphenyl)hexanoic acid

C12H17NO4 — CID 174512800

IUPAC2-amino-4-(2,5-dihydroxyphenyl)hexanoic acid
SMILESCCC(CC(N)C(=O)O)c1cc(O)ccc1O
InChIInChI=1S/C12H17NO4/c1-2-7(5-10(13)12(16)17)9-6-8(14)3-4-11(9)15/h3-4,6-7,10,14-15H,2,5,13H2,1H3,(H,16,17)
InChIKeyRZAJPZYJPWLAFN-UHFFFAOYSA-N
MW239.27 g/mol
LogP1.39
Rot. Bonds5

About 2-amino-4-(2,5-dihydroxyphenyl)hexanoic acid

2-amino-4-(2,5-dihydroxyphenyl)hexanoic acid (PubChem CID 174512800) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 2-amino-4-(2,5-dihydroxyphenyl)hexanoic acid.

Molecular Properties

Compound Name2-amino-4-(2,5-dihydroxyphenyl)hexanoic acid
PubChem CID174512800
Molecular FormulaC12H17NO4
Molecular Weight239.27 g/mol
Exact Mass239.12
IUPAC Name2-amino-4-(2,5-dihydroxyphenyl)hexanoic acid
SMILESCCC(CC(N)C(=O)O)c1cc(O)ccc1O
InChIInChI=1S/C12H17NO4/c1-2-7(5-10(13)12(16)17)9-6-8(14)3-4-11(9)15/h3-4,6-7,10,14-15H,2,5,13H2,1H3,(H,16,17)
InChIKeyRZAJPZYJPWLAFN-UHFFFAOYSA-N
XLogP1.39
TPSA103.78 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.27
LogP ≤ 51.39
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydroquinone', 'substructure': 'N/A'}

Analyze 2-amino-4-(2,5-dihydroxyphenyl)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-4-(2,5-dihydroxyphenyl)hexanoic acid?
The IUPAC name of 2-amino-4-(2,5-dihydroxyphenyl)hexanoic acid (CID 174512800) is 2-amino-4-(2,5-dihydroxyphenyl)hexanoic acid.
What is the SMILES notation for 2-amino-4-(2,5-dihydroxyphenyl)hexanoic acid?
The canonical SMILES for 2-amino-4-(2,5-dihydroxyphenyl)hexanoic acid is CCC(CC(N)C(=O)O)c1cc(O)ccc1O.
What is the InChIKey of 2-amino-4-(2,5-dihydroxyphenyl)hexanoic acid?
The InChIKey is RZAJPZYJPWLAFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO4/c1-2-7(5-10(13)12(16)17)9-6-8(14)3-4-11(9)15/h3-4,6-7,10,14-15H,2,5,13H2,1H3,(H,16,17).
What are the key properties of 2-amino-4-(2,5-dihydroxyphenyl)hexanoic acid?
2-amino-4-(2,5-dihydroxyphenyl)hexanoic acid has a molecular weight of 239.27 g/mol, XLogP of 1.39, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(2,5-dihydroxyphenyl)hexanoic acid is sourced from PubChem (CID 174512800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).