2-amino-4-ethyl-5-(2,3,4-trihydroxyphenyl)hexanoic acid

C14H21NO5 — CID 174497866

IUPAC2-amino-4-ethyl-5-(2,3,4-trihydroxyphenyl)hexanoic acid
SMILESCCC(CC(N)C(=O)O)C(C)c1ccc(O)c(O)c1O
InChIInChI=1S/C14H21NO5/c1-3-8(6-10(15)14(19)20)7(2)9-4-5-11(16)13(18)12(9)17/h4-5,7-8,10,16-18H,3,6,15H2,1-2H3,(H,19,20)
InChIKeyCDCZLTDKRYPTPQ-UHFFFAOYSA-N
MW283.32 g/mol
LogP1.74
Rot. Bonds6

About 2-amino-4-ethyl-5-(2,3,4-trihydroxyphenyl)hexanoic acid

2-amino-4-ethyl-5-(2,3,4-trihydroxyphenyl)hexanoic acid (PubChem CID 174497866) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-amino-4-ethyl-5-(2,3,4-trihydroxyphenyl)hexanoic acid.

Molecular Properties

Compound Name2-amino-4-ethyl-5-(2,3,4-trihydroxyphenyl)hexanoic acid
PubChem CID174497866
Molecular FormulaC14H21NO5
Molecular Weight283.32 g/mol
Exact Mass283.14
IUPAC Name2-amino-4-ethyl-5-(2,3,4-trihydroxyphenyl)hexanoic acid
SMILESCCC(CC(N)C(=O)O)C(C)c1ccc(O)c(O)c1O
InChIInChI=1S/C14H21NO5/c1-3-8(6-10(15)14(19)20)7(2)9-4-5-11(16)13(18)12(9)17/h4-5,7-8,10,16-18H,3,6,15H2,1-2H3,(H,19,20)
InChIKeyCDCZLTDKRYPTPQ-UHFFFAOYSA-N
XLogP1.74
TPSA124.01 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.32
LogP ≤ 51.74
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}

Analyze 2-amino-4-ethyl-5-(2,3,4-trihydroxyphenyl)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-4-ethyl-5-(2,3,4-trihydroxyphenyl)hexanoic acid?
The IUPAC name of 2-amino-4-ethyl-5-(2,3,4-trihydroxyphenyl)hexanoic acid (CID 174497866) is 2-amino-4-ethyl-5-(2,3,4-trihydroxyphenyl)hexanoic acid.
What is the SMILES notation for 2-amino-4-ethyl-5-(2,3,4-trihydroxyphenyl)hexanoic acid?
The canonical SMILES for 2-amino-4-ethyl-5-(2,3,4-trihydroxyphenyl)hexanoic acid is CCC(CC(N)C(=O)O)C(C)c1ccc(O)c(O)c1O.
What is the InChIKey of 2-amino-4-ethyl-5-(2,3,4-trihydroxyphenyl)hexanoic acid?
The InChIKey is CDCZLTDKRYPTPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO5/c1-3-8(6-10(15)14(19)20)7(2)9-4-5-11(16)13(18)12(9)17/h4-5,7-8,10,16-18H,3,6,15H2,1-2H3,(H,19,20).
What are the key properties of 2-amino-4-ethyl-5-(2,3,4-trihydroxyphenyl)hexanoic acid?
2-amino-4-ethyl-5-(2,3,4-trihydroxyphenyl)hexanoic acid has a molecular weight of 283.32 g/mol, XLogP of 1.74, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-ethyl-5-(2,3,4-trihydroxyphenyl)hexanoic acid is sourced from PubChem (CID 174497866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).