C14H21NO5 — CID 174497866
2-amino-4-ethyl-5-(2,3,4-trihydroxyphenyl)hexanoic acid (PubChem CID 174497866) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-amino-4-ethyl-5-(2,3,4-trihydroxyphenyl)hexanoic acid.
| Compound Name | 2-amino-4-ethyl-5-(2,3,4-trihydroxyphenyl)hexanoic acid |
|---|---|
| PubChem CID | 174497866 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-amino-4-ethyl-5-(2,3,4-trihydroxyphenyl)hexanoic acid |
| SMILES | CCC(CC(N)C(=O)O)C(C)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C14H21NO5/c1-3-8(6-10(15)14(19)20)7(2)9-4-5-11(16)13(18)12(9)17/h4-5,7-8,10,16-18H,3,6,15H2,1-2H3,(H,19,20) |
| InChIKey | CDCZLTDKRYPTPQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|