C12H18N2O4 — CID 166652499
3-(2,5-dihydroxyphenyl)-2-hydrazinyl-2-methylpentanoic acid (PubChem CID 166652499) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 3-(2,5-dihydroxyphenyl)-2-hydrazinyl-2-methylpentanoic acid.
| Compound Name | 3-(2,5-dihydroxyphenyl)-2-hydrazinyl-2-methylpentanoic acid |
|---|---|
| PubChem CID | 166652499 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 3-(2,5-dihydroxyphenyl)-2-hydrazinyl-2-methylpentanoic acid |
| SMILES | CCC(c1cc(O)ccc1O)C(C)(NN)C(=O)O |
| InChI | InChI=1S/C12H18N2O4/c1-3-9(12(2,14-13)11(17)18)8-6-7(15)4-5-10(8)16/h4-6,9,14-16H,3,13H2,1-2H3,(H,17,18) |
| InChIKey | DXILXJAMQDUBSC-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|