C14H21NO4 — CID 65055932
2-[1-(2,5-dihydroxyphenyl)ethylamino]-2-methylpentanoic acid (PubChem CID 65055932) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 2-[1-(2,5-dihydroxyphenyl)ethylamino]-2-methylpentanoic acid.
| Compound Name | 2-[1-(2,5-dihydroxyphenyl)ethylamino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 65055932 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2-[1-(2,5-dihydroxyphenyl)ethylamino]-2-methylpentanoic acid |
| SMILES | CCCC(C)(NC(C)c1cc(O)ccc1O)C(=O)O |
| InChI | InChI=1S/C14H21NO4/c1-4-7-14(3,13(18)19)15-9(2)11-8-10(16)5-6-12(11)17/h5-6,8-9,15-17H,4,7H2,1-3H3,(H,18,19) |
| InChIKey | MSSLUDUXXQLRNX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|