C16H27NO2 — CID 43731188
2-[1-(2,4,4-trimethylpentan-2-ylamino)ethyl]benzene-1,4-diol (PubChem CID 43731188) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-[1-(2,4,4-trimethylpentan-2-ylamino)ethyl]benzene-1,4-diol.
| Compound Name | 2-[1-(2,4,4-trimethylpentan-2-ylamino)ethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 43731188 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 2-[1-(2,4,4-trimethylpentan-2-ylamino)ethyl]benzene-1,4-diol |
| SMILES | CC(NC(C)(C)CC(C)(C)C)c1cc(O)ccc1O |
| InChI | InChI=1S/C16H27NO2/c1-11(13-9-12(18)7-8-14(13)19)17-16(5,6)10-15(2,3)4/h7-9,11,17-19H,10H2,1-6H3 |
| InChIKey | JNVHTYZLNUFMTI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|