C18H23NO2 — CID 43682928
2-[1-(2-tert-butylanilino)ethyl]benzene-1,4-diol (PubChem CID 43682928) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-[1-(2-tert-butylanilino)ethyl]benzene-1,4-diol.
| Compound Name | 2-[1-(2-tert-butylanilino)ethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 43682928 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 2-[1-(2-tert-butylanilino)ethyl]benzene-1,4-diol |
| SMILES | CC(Nc1ccccc1C(C)(C)C)c1cc(O)ccc1O |
| InChI | InChI=1S/C18H23NO2/c1-12(14-11-13(20)9-10-17(14)21)19-16-8-6-5-7-15(16)18(2,3)4/h5-12,19-21H,1-4H3 |
| InChIKey | ZBSLGPPJLAMAMO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|