C13H13ClN2O2 — CID 43689977
2-[1-[(2-chloro-3-pyridinyl)amino]ethyl]benzene-1,4-diol (PubChem CID 43689977) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is 2-[1-[(2-chloro-3-pyridinyl)amino]ethyl]benzene-1,4-diol.
| Compound Name | 2-[1-[(2-chloro-3-pyridinyl)amino]ethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 43689977 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-[1-[(2-chloro-3-pyridinyl)amino]ethyl]benzene-1,4-diol |
| SMILES | CC(Nc1cccnc1Cl)c1cc(O)ccc1O |
| InChI | InChI=1S/C13H13ClN2O2/c1-8(10-7-9(17)4-5-12(10)18)16-11-3-2-6-15-13(11)14/h2-8,16-18H,1H3 |
| InChIKey | GCZVRFLLOBZTAK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|