C14H24N2O4S2 — CID 87462406
2-[1-[[1-[(2-amino-3-hydroxypropyl)disulfanyl]-3-hydroxypropan-2-yl]amino]ethyl]benzene-1,4-diol (PubChem CID 87462406) has the molecular formula C14H24N2O4S2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 2-[1-[[1-[(2-amino-3-hydroxypropyl)disulfanyl]-3-hydroxypropan-2-yl]amino]ethyl]benzene-1,4-diol.
| Compound Name | 2-[1-[[1-[(2-amino-3-hydroxypropyl)disulfanyl]-3-hydroxypropan-2-yl]amino]ethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 87462406 |
| Molecular Formula | C14H24N2O4S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-[1-[[1-[(2-amino-3-hydroxypropyl)disulfanyl]-3-hydroxypropan-2-yl]amino]ethyl]benzene-1,4-diol |
| SMILES | CC(NC(CO)CSSCC(N)CO)c1cc(O)ccc1O |
| InChI | InChI=1S/C14H24N2O4S2/c1-9(13-4-12(19)2-3-14(13)20)16-11(6-18)8-22-21-7-10(15)5-17/h2-4,9-11,16-20H,5-8,15H2,1H3 |
| InChIKey | CUSIXMTZZARQMV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|