C9H10NNaO4 — CID 170902484
sodium (2S)-2-amino-3-(2,4-dihydroxyphenyl)propanoate (PubChem CID 170902484) has the molecular formula C9H10NNaO4 and a molecular weight of 219.17 g/mol. Its IUPAC name is sodium (2S)-2-amino-3-(2,4-dihydroxyphenyl)propanoate.
| Compound Name | sodium (2S)-2-amino-3-(2,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 170902484 |
| Molecular Formula | C9H10NNaO4 |
| Molecular Weight | 219.17 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | sodium (2S)-2-amino-3-(2,4-dihydroxyphenyl)propanoate |
| SMILES | N[C@@H](Cc1ccc(O)cc1O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C9H11NO4.Na/c10-7(9(13)14)3-5-1-2-6(11)4-8(5)12;/h1-2,4,7,11-12H,3,10H2,(H,13,14);/q;+1/p-1/t7-;/m0./s1 |
| InChIKey | SLYOBXYHAAJPNO-FJXQXJEOSA-M |
| XLogP | -4.28 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.17 |
| LogP ≤ 5 | -4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |