C15H14O5 — CID 71744426
3-(2,4-dihydroxyphenyl)-2-(4-hydroxyphenyl)propanoic acid (PubChem CID 71744426) has the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. Its IUPAC name is 3-(2,4-dihydroxyphenyl)-2-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 3-(2,4-dihydroxyphenyl)-2-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 71744426 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 3-(2,4-dihydroxyphenyl)-2-(4-hydroxyphenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(O)cc1O)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H14O5/c16-11-4-1-9(2-5-11)13(15(19)20)7-10-3-6-12(17)8-14(10)18/h1-6,8,13,16-18H,7H2,(H,19,20) |
| InChIKey | ZWSZGLSUFUKLCL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |