C15H16O4 — CID 78166649
4-[3-hydroxy-2-(4-hydroxyphenyl)propyl]benzene-1,3-diol (PubChem CID 78166649) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-[3-hydroxy-2-(4-hydroxyphenyl)propyl]benzene-1,3-diol.
| Compound Name | 4-[3-hydroxy-2-(4-hydroxyphenyl)propyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 78166649 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 4-[3-hydroxy-2-(4-hydroxyphenyl)propyl]benzene-1,3-diol |
| SMILES | OCC(Cc1ccc(O)cc1O)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H16O4/c16-9-12(10-1-4-13(17)5-2-10)7-11-3-6-14(18)8-15(11)19/h1-6,8,12,16-19H,7,9H2 |
| InChIKey | SRUZJXFKTNHVQL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |