C10H14O3 — CID 139687433
2-(4-hydroxyphenyl)butane-1,4-diol (PubChem CID 139687433) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)butane-1,4-diol.
| Compound Name | 2-(4-hydroxyphenyl)butane-1,4-diol |
|---|---|
| PubChem CID | 139687433 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-(4-hydroxyphenyl)butane-1,4-diol |
| SMILES | OCCC(CO)c1ccc(O)cc1 |
| InChI | InChI=1S/C10H14O3/c11-6-5-9(7-12)8-1-3-10(13)4-2-8/h1-4,9,11-13H,5-7H2 |
| InChIKey | CBHFBYKSUTZJMS-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |